C15H16FN3O3 — CID 99791300
methyl (2R)-2-[[2-(2-fluorophenyl)acetyl]amino]-2-(3-methylimidazol-4-yl)acetate (PubChem CID 99791300) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(2-fluorophenyl)acetyl]amino]-2-(3-methylimidazol-4-yl)acetate.
| Compound Name | methyl (2R)-2-[[2-(2-fluorophenyl)acetyl]amino]-2-(3-methylimidazol-4-yl)acetate |
|---|---|
| PubChem CID | 99791300 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl (2R)-2-[[2-(2-fluorophenyl)acetyl]amino]-2-(3-methylimidazol-4-yl)acetate |
| SMILES | COC(=O)[C@H](NC(=O)Cc1ccccc1F)c1cncn1C |
| InChI | InChI=1S/C15H16FN3O3/c1-19-9-17-8-12(19)14(15(21)22-2)18-13(20)7-10-5-3-4-6-11(10)16/h3-6,8-9,14H,7H2,1-2H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | FYLJWANONACDMI-CQSZACIVSA-N |
| XLogP | 1.13 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |