About (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine
(2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine (PubChem CID 99792018) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine.
Molecular Properties
| Compound Name | (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine |
| PubChem CID | 99792018 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine |
| SMILES | c1coc([C@@H]2CN(CCCc3ccc4c(c3)CCO4)CCO2)c1 |
| InChI | InChI=1S/C19H23NO3/c1(3-15-5-6-17-16(13-15)7-11-22-17)8-20-9-12-23-19(14-20)18-4-2-10-21-18/h2,4-6,10,13,19H,1,3,7-9,11-12,14H2/t19-/m0/s1 |
| InChIKey | KRPGSLGGWHAFFR-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine?
The IUPAC name of (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine (CID 99792018) is (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine.
What is the SMILES notation for (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine?
The canonical SMILES for (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine is c1coc([C@@H]2CN(CCCc3ccc4c(c3)CCO4)CCO2)c1.
What is the InChIKey of (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine?
The InChIKey is KRPGSLGGWHAFFR-IBGZPJMESA-N. The full InChI is InChI=1S/C19H23NO3/c1(3-15-5-6-17-16(13-15)7-11-22-17)8-20-9-12-23-19(14-20)18-4-2-10-21-18/h2,4-6,10,13,19H,1,3,7-9,11-12,14H2/t19-/m0/s1.
What are the key properties of (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine?
(2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine has a molecular weight of 313.40 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[3-(2,3-dihydro-1-benzofuran-5-yl)propyl]-2-(furan-2-yl)morpholine is sourced from PubChem (CID 99792018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).