C18H25ClN2O3 — CID 99792785
(3R)-N-[(2R)-2-(4-chlorophenoxy)propyl]-3-(2-oxopiperidin-1-yl)butanamide (PubChem CID 99792785) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-(4-chlorophenoxy)propyl]-3-(2-oxopiperidin-1-yl)butanamide.
| Compound Name | (3R)-N-[(2R)-2-(4-chlorophenoxy)propyl]-3-(2-oxopiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 99792785 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3R)-N-[(2R)-2-(4-chlorophenoxy)propyl]-3-(2-oxopiperidin-1-yl)butanamide |
| SMILES | C[C@H](CNC(=O)C[C@@H](C)N1CCCCC1=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-13(21-10-4-3-5-18(21)23)11-17(22)20-12-14(2)24-16-8-6-15(19)7-9-16/h6-9,13-14H,3-5,10-12H2,1-2H3,(H,20,22)/t13-,14-/m1/s1 |
| InChIKey | DFYKMJCWHOOKIP-ZIAGYGMSSA-N |
| XLogP | 3.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |