C10H12N4O2S — CID 99793193
(4aS,7aR)-1-(1,2,5-thiadiazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 99793193) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is (4aS,7aR)-1-(1,2,5-thiadiazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aS,7aR)-1-(1,2,5-thiadiazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 99793193 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (4aS,7aR)-1-(1,2,5-thiadiazole-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC[C@H]2[C@@H]1CCCN2C(=O)c1cnsn1 |
| InChI | InChI=1S/C10H12N4O2S/c15-9-6-2-1-3-14(8(6)5-11-9)10(16)7-4-12-17-13-7/h4,6,8H,1-3,5H2,(H,11,15)/t6-,8-/m0/s1 |
| InChIKey | HHFPKCZTVMPDQK-XPUUQOCRSA-N |
| XLogP | -0.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |