About 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid
4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid (PubChem CID 99794663) has the molecular formula C18H18N2O9S
and a molecular weight of 438.41 g/mol. Its IUPAC name is 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid |
| PubChem CID | 99794663 |
| Molecular Formula | C18H18N2O9S |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid |
| SMILES | COC(=O)c1c[nH]c(C(=O)OC)c1NS(=O)(=O)c1ccc(C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H18N2O9S/c1-28-17(24)12-9-19-16(18(25)29-2)15(12)20-30(26,27)11-5-3-10(4-6-11)13(21)7-8-14(22)23/h3-6,9,19-20H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | MFPOEZIRMWIZKH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 168.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid?
The IUPAC name of 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid (CID 99794663) is 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid?
The canonical SMILES for 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid is COC(=O)c1c[nH]c(C(=O)OC)c1NS(=O)(=O)c1ccc(C(=O)CCC(=O)O)cc1.
What is the InChIKey of 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid?
The InChIKey is MFPOEZIRMWIZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O9S/c1-28-17(24)12-9-19-16(18(25)29-2)15(12)20-30(26,27)11-5-3-10(4-6-11)13(21)7-8-14(22)23/h3-6,9,19-20H,7-8H2,1-2H3,(H,22,23).
What are the key properties of 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid?
4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid has a molecular weight of 438.41 g/mol, XLogP of 1.44, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[2,4-bis(methoxycarbonyl)-1H-pyrrol-3-yl]sulfamoyl]phenyl]-4-oxobutanoic acid is sourced from PubChem (CID 99794663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).