C18H19N3O2S — CID 99794690
N-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)thiadiazole-5-carboxamide (PubChem CID 99794690) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)thiadiazole-5-carboxamide.
| Compound Name | N-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 99794690 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)thiadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2nnsc2C(=O)NC[C@H]2C[C@@H]3C=C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-23-15-6-4-12(5-7-15)16-17(24-21-20-16)18(22)19-10-14-9-11-2-3-13(14)8-11/h2-7,11,13-14H,8-10H2,1H3,(H,19,22)/t11-,13-,14-/m1/s1 |
| InChIKey | YYWFASJTLNXTAU-MRVWCRGKSA-N |
| XLogP | 3.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|