C18H20N2O — CID 99794880
N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-5-carboxamide (PubChem CID 99794880) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-5-carboxamide.
| Compound Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-5-carboxamide |
|---|---|
| PubChem CID | 99794880 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methylindole-5-carboxamide |
| SMILES | Cn1ccc2cc(C(=O)NC[C@@H]3C[C@H]4C=C[C@@H]3C4)ccc21 |
| InChI | InChI=1S/C18H20N2O/c1-20-7-6-14-10-15(4-5-17(14)20)18(21)19-11-16-9-12-2-3-13(16)8-12/h2-7,10,12-13,16H,8-9,11H2,1H3,(H,19,21)/t12-,13+,16-/m0/s1 |
| InChIKey | GADGEYQNEKBZJW-ZENOOKHLSA-N |
| XLogP | 3.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|