C19H30N4O4 — CID 99794916
2,6-bis[(3S)-3-(methoxymethyl)piperidin-1-yl]-3-nitropyridine (PubChem CID 99794916) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2,6-bis[(3S)-3-(methoxymethyl)piperidin-1-yl]-3-nitropyridine.
| Compound Name | 2,6-bis[(3S)-3-(methoxymethyl)piperidin-1-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 99794916 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2,6-bis[(3S)-3-(methoxymethyl)piperidin-1-yl]-3-nitropyridine |
| SMILES | COC[C@H]1CCCN(c2ccc([N+](=O)[O-])c(N3CCC[C@H](COC)C3)n2)C1 |
| InChI | InChI=1S/C19H30N4O4/c1-26-13-15-5-3-9-21(11-15)18-8-7-17(23(24)25)19(20-18)22-10-4-6-16(12-22)14-27-2/h7-8,15-16H,3-6,9-14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | PQOLFEDGBNQOJT-HOTGVXAUSA-N |
| XLogP | 2.72 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|