C17H20ClN5O — CID 99795052
6-chloro-N-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 99795052) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is 6-chloro-N-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 6-chloro-N-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 99795052 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 6-chloro-N-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1nc2n(n1)C[C@H](NC(=O)N1CCc3cc(Cl)ccc3C1)CC2 |
| InChI | InChI=1S/C17H20ClN5O/c1-11-19-16-5-4-15(10-23(16)21-11)20-17(24)22-7-6-12-8-14(18)3-2-13(12)9-22/h2-3,8,15H,4-7,9-10H2,1H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | BZKOORBNDYNDRX-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |