C17H24ClN3O4 — CID 99795763
methyl 2-[4-[(3-chloro-4-propan-2-yloxyphenyl)carbamoyl]piperazin-1-yl]acetate (PubChem CID 99795763) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl 2-[4-[(3-chloro-4-propan-2-yloxyphenyl)carbamoyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-chloro-4-propan-2-yloxyphenyl)carbamoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 99795763 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl 2-[4-[(3-chloro-4-propan-2-yloxyphenyl)carbamoyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)Nc2ccc(OC(C)C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-12(2)25-15-5-4-13(10-14(15)18)19-17(23)21-8-6-20(7-9-21)11-16(22)24-3/h4-5,10,12H,6-9,11H2,1-3H3,(H,19,23) |
| InChIKey | HIARDCYVPALSSD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |