About Cyclopentanepropionic acid, 2-oxo-1-phenyl-
Cyclopentanepropionic acid, 2-oxo-1-phenyl- (PubChem CID 99796) has the molecular formula C14H16O3
and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-(2-oxo-1-phenylcyclopentyl)propanoic acid.
Molecular Properties
| Compound Name | Cyclopentanepropionic acid, 2-oxo-1-phenyl- |
| PubChem CID | 99796 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(2-oxo-1-phenylcyclopentyl)propanoic acid |
| SMILES | C1CC(=O)C(C1)(CCC(=O)O)C2=CC=CC=C2 |
| InChI | InChI=1S/C14H16O3/c15-12-7-4-9-14(12,10-8-13(16)17)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,16,17) |
| InChIKey | FBUOKAZGLNYOTA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 305 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Cyclopentanepropionic acid, 2-oxo-1-phenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclopentanepropionic acid, 2-oxo-1-phenyl-?
The IUPAC name of Cyclopentanepropionic acid, 2-oxo-1-phenyl- (CID 99796) is 3-(2-oxo-1-phenylcyclopentyl)propanoic acid.
What is the SMILES notation for Cyclopentanepropionic acid, 2-oxo-1-phenyl-?
The canonical SMILES for Cyclopentanepropionic acid, 2-oxo-1-phenyl- is C1CC(=O)C(C1)(CCC(=O)O)C2=CC=CC=C2.
What is the InChIKey of Cyclopentanepropionic acid, 2-oxo-1-phenyl-?
The InChIKey is FBUOKAZGLNYOTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c15-12-7-4-9-14(12,10-8-13(16)17)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,16,17).
What are the key properties of Cyclopentanepropionic acid, 2-oxo-1-phenyl-?
Cyclopentanepropionic acid, 2-oxo-1-phenyl- has a molecular weight of 232.27 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclopentanepropionic acid, 2-oxo-1-phenyl- is sourced from PubChem (CID 99796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).