C19H33N3O3 — CID 99796786
2-[(E)-[amino-[(2S,3R)-2-tert-butyloxolan-3-yl]methylidene]amino]oxy-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 99796786) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[(E)-[amino-[(2S,3R)-2-tert-butyloxolan-3-yl]methylidene]amino]oxy-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[(E)-[amino-[(2S,3R)-2-tert-butyloxolan-3-yl]methylidene]amino]oxy-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 99796786 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 2-[(E)-[amino-[(2S,3R)-2-tert-butyloxolan-3-yl]methylidene]amino]oxy-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | CC(C)(C)[C@H]1OCC[C@@H]1/C(N)=N\OCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H33N3O3/c1-19(2,3)17-15(10-12-24-17)18(20)22-25-13-16(23)21-11-9-14-7-5-4-6-8-14/h7,15,17H,4-6,8-13H2,1-3H3,(H2,20,22)(H,21,23)/t15-,17-/m0/s1 |
| InChIKey | CPLHYNOEYBERMG-RDJZCZTQSA-N |
| XLogP | 2.73 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|