C17H18N2O4 — CID 99797134
3-[2-[[(1R)-1-(3-hydroxyphenyl)ethyl]amino]-2-oxoethoxy]benzamide (PubChem CID 99797134) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-[2-[[(1R)-1-(3-hydroxyphenyl)ethyl]amino]-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-[[(1R)-1-(3-hydroxyphenyl)ethyl]amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 99797134 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[2-[[(1R)-1-(3-hydroxyphenyl)ethyl]amino]-2-oxoethoxy]benzamide |
| SMILES | C[C@@H](NC(=O)COc1cccc(C(N)=O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11(12-4-2-6-14(20)8-12)19-16(21)10-23-15-7-3-5-13(9-15)17(18)22/h2-9,11,20H,10H2,1H3,(H2,18,22)(H,19,21)/t11-/m1/s1 |
| InChIKey | BPDSFNSLVBEVLH-LLVKDONJSA-N |
| XLogP | 1.75 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |