C15H15BrN2O3 — CID 99797440
(6R,7aS)-2-[(1R)-4-bromo-2,3-dihydro-1H-inden-1-yl]-6-hydroxy-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 99797440) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is (6R,7aS)-2-[(1R)-4-bromo-2,3-dihydro-1H-inden-1-yl]-6-hydroxy-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aS)-2-[(1R)-4-bromo-2,3-dihydro-1H-inden-1-yl]-6-hydroxy-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 99797440 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (6R,7aS)-2-[(1R)-4-bromo-2,3-dihydro-1H-inden-1-yl]-6-hydroxy-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1[C@@H]2C[C@@H](O)CN2C(=O)N1[C@@H]1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C15H15BrN2O3/c16-11-3-1-2-10-9(11)4-5-12(10)18-14(20)13-6-8(19)7-17(13)15(18)21/h1-3,8,12-13,19H,4-7H2/t8-,12-,13+/m1/s1 |
| InChIKey | QJLJZNWMRORYER-WQHBLYJGSA-N |
| XLogP | 1.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|