C17H18Cl2N4O2 — CID 99797466
(5S)-5-[(3,5-dichlorophenyl)methyl]-3-[(1-propan-2-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 99797466) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is (5S)-5-[(3,5-dichlorophenyl)methyl]-3-[(1-propan-2-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(3,5-dichlorophenyl)methyl]-3-[(1-propan-2-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99797466 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (5S)-5-[(3,5-dichlorophenyl)methyl]-3-[(1-propan-2-ylpyrazol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)n1ccc(CN2C(=O)N[C@@H](Cc3cc(Cl)cc(Cl)c3)C2=O)n1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c1-10(2)23-4-3-14(21-23)9-22-16(24)15(20-17(22)25)7-11-5-12(18)8-13(19)6-11/h3-6,8,10,15H,7,9H2,1-2H3,(H,20,25)/t15-/m0/s1 |
| InChIKey | XKBOABZZGGPWHR-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|