C23H36N2O6 — CID 99797772
(3S)-N-[2-(2,2-diethoxyethoxy)ethyl]-1-(3-phenoxypropanoyl)piperidine-3-carboxamide (PubChem CID 99797772) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is (3S)-N-[2-(2,2-diethoxyethoxy)ethyl]-1-(3-phenoxypropanoyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(2,2-diethoxyethoxy)ethyl]-1-(3-phenoxypropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99797772 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3S)-N-[2-(2,2-diethoxyethoxy)ethyl]-1-(3-phenoxypropanoyl)piperidine-3-carboxamide |
| SMILES | CCOC(COCCNC(=O)[C@H]1CCCN(C(=O)CCOc2ccccc2)C1)OCC |
| InChI | InChI=1S/C23H36N2O6/c1-3-29-22(30-4-2)18-28-16-13-24-23(27)19-9-8-14-25(17-19)21(26)12-15-31-20-10-6-5-7-11-20/h5-7,10-11,19,22H,3-4,8-9,12-18H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | LUMVCTJCXBYTHK-IBGZPJMESA-N |
| XLogP | 2.23 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|