About N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide
N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide (PubChem CID 99798757) has the molecular formula C13H12F2N4O
and a molecular weight of 278.26 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide |
| PubChem CID | 99798757 |
| Molecular Formula | C13H12F2N4O |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide |
| SMILES | CN(CCC#N)C(=O)Cn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C13H12F2N4O/c1-18(4-2-3-16)13(20)7-19-8-17-11-5-9(14)10(15)6-12(11)19/h5-6,8H,2,4,7H2,1H3 |
| InChIKey | LRDYZDDDTVSMGB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The IUPAC name of N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide (CID 99798757) is N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide.
What is the SMILES notation for N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The canonical SMILES for N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide is CN(CCC#N)C(=O)Cn1cnc2cc(F)c(F)cc21.
What is the InChIKey of N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
The InChIKey is LRDYZDDDTVSMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N4O/c1-18(4-2-3-16)13(20)7-19-8-17-11-5-9(14)10(15)6-12(11)19/h5-6,8H,2,4,7H2,1H3.
What are the key properties of N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide?
N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide has a molecular weight of 278.26 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-2-(5,6-difluorobenzimidazol-1-yl)-N-methylacetamide is sourced from PubChem (CID 99798757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).