About N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide
N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide (PubChem CID 99798816) has the molecular formula C19H15N3O3
and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide |
| PubChem CID | 99798816 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1CC(=O)[C@@H](C#N)c1nc2ccccc2o1 |
| InChI | InChI=1S/C19H15N3O3/c1-12(23)21-15-7-3-2-6-13(15)10-17(24)14(11-20)19-22-16-8-4-5-9-18(16)25-19/h2-9,14H,10H2,1H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | WOBNRTYBCXJTSO-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide?
The IUPAC name of N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide (CID 99798816) is N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide.
What is the SMILES notation for N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide?
The canonical SMILES for N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide is CC(=O)Nc1ccccc1CC(=O)[C@@H](C#N)c1nc2ccccc2o1.
What is the InChIKey of N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide?
The InChIKey is WOBNRTYBCXJTSO-CQSZACIVSA-N. The full InChI is InChI=1S/C19H15N3O3/c1-12(23)21-15-7-3-2-6-13(15)10-17(24)14(11-20)19-22-16-8-4-5-9-18(16)25-19/h2-9,14H,10H2,1H3,(H,21,23)/t14-/m1/s1.
What are the key properties of N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide?
N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide has a molecular weight of 333.35 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3S)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl]phenyl]acetamide is sourced from PubChem (CID 99798816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).