C18H23ClN4O2 — CID 99799848
3-pyrrolidin-1-ylpropyl 3-chloro-6-(3,5-dimethylpyrazol-1-yl)pyridine-2-carboxylate (PubChem CID 99799848) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl 3-chloro-6-(3,5-dimethylpyrazol-1-yl)pyridine-2-carboxylate.
| Compound Name | 3-pyrrolidin-1-ylpropyl 3-chloro-6-(3,5-dimethylpyrazol-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 99799848 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl 3-chloro-6-(3,5-dimethylpyrazol-1-yl)pyridine-2-carboxylate |
| SMILES | Cc1cc(C)n(-c2ccc(Cl)c(C(=O)OCCCN3CCCC3)n2)n1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-13-12-14(2)23(21-13)16-7-6-15(19)17(20-16)18(24)25-11-5-10-22-8-3-4-9-22/h6-7,12H,3-5,8-11H2,1-2H3 |
| InChIKey | DWGMGRVUTCHOAE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|