About 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate
3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 99799902) has the molecular formula C17H20FN3O2
and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate |
| PubChem CID | 99799902 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | O=C(OCCCN1CCCC1)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C17H20FN3O2/c18-14-6-4-13(5-7-14)15-12-16(20-19-15)17(22)23-11-3-10-21-8-1-2-9-21/h4-7,12H,1-3,8-11H2,(H,19,20) |
| InChIKey | ZBJRPYFHQVHIOM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The IUPAC name of 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate (CID 99799902) is 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate.
What is the SMILES notation for 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The canonical SMILES for 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate is O=C(OCCCN1CCCC1)c1cc(-c2ccc(F)cc2)n[nH]1.
What is the InChIKey of 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
The InChIKey is ZBJRPYFHQVHIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2/c18-14-6-4-13(5-7-14)15-12-16(20-19-15)17(22)23-11-3-10-21-8-1-2-9-21/h4-7,12H,1-3,8-11H2,(H,19,20).
What are the key properties of 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate?
3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate has a molecular weight of 317.36 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylpropyl 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 99799902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).