C11H8F3N3O3S2 — CID 998002
2,2,2-trifluoro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 998002) has the molecular formula C11H8F3N3O3S2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 998002 |
| Molecular Formula | C11H8F3N3O3S2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H8F3N3O3S2/c12-11(13,14)9(18)16-7-1-3-8(4-2-7)22(19,20)17-10-15-5-6-21-10/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | QDYXPBDOAWYGEO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |