C11H15F4N5O2 — CID 99800241
1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-(2,2,3,3-tetrafluoropropyl)urea (PubChem CID 99800241) has the molecular formula C11H15F4N5O2 and a molecular weight of 325.27 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-(2,2,3,3-tetrafluoropropyl)urea.
| Compound Name | 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-(2,2,3,3-tetrafluoropropyl)urea |
|---|---|
| PubChem CID | 99800241 |
| Molecular Formula | C11H15F4N5O2 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-(2,2,3,3-tetrafluoropropyl)urea |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4N5O2/c1-20(2)7-6(8(22-3)18-5-17-7)19-10(21)16-4-11(14,15)9(12)13/h5,9H,4H2,1-3H3,(H2,16,19,21) |
| InChIKey | ORIWZKAROLKFSX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|