C10H6F3N3O2S — CID 99800813
3,4,5-trifluoro-N-(4-methyl-5-oxo-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 99800813) has the molecular formula C10H6F3N3O2S and a molecular weight of 289.24 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(4-methyl-5-oxo-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(4-methyl-5-oxo-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 99800813 |
| Molecular Formula | C10H6F3N3O2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3,4,5-trifluoro-N-(4-methyl-5-oxo-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | Cn1nc(NC(=O)c2cc(F)c(F)c(F)c2)sc1=O |
| InChI | InChI=1S/C10H6F3N3O2S/c1-16-10(18)19-9(15-16)14-8(17)4-2-5(11)7(13)6(12)3-4/h2-3H,1H3,(H,14,15,17) |
| InChIKey | UYZYXCMRPBUZMK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|