C14H15N3O2S — CID 99801050
1-[5-[(2R)-2-(1H-pyrazol-5-yl)pyrrolidine-1-carbonyl]thiophen-3-yl]ethanone (PubChem CID 99801050) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[5-[(2R)-2-(1H-pyrazol-5-yl)pyrrolidine-1-carbonyl]thiophen-3-yl]ethanone.
| Compound Name | 1-[5-[(2R)-2-(1H-pyrazol-5-yl)pyrrolidine-1-carbonyl]thiophen-3-yl]ethanone |
|---|---|
| PubChem CID | 99801050 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-[5-[(2R)-2-(1H-pyrazol-5-yl)pyrrolidine-1-carbonyl]thiophen-3-yl]ethanone |
| SMILES | CC(=O)c1csc(C(=O)N2CCC[C@@H]2c2ccn[nH]2)c1 |
| InChI | InChI=1S/C14H15N3O2S/c1-9(18)10-7-13(20-8-10)14(19)17-6-2-3-12(17)11-4-5-15-16-11/h4-5,7-8,12H,2-3,6H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | HYVALGAGCIAVHQ-GFCCVEGCSA-N |
| XLogP | 2.65 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |