C13H19F3N6 — CID 99801920
N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 99801920) has the molecular formula C13H19F3N6 and a molecular weight of 316.33 g/mol. Its IUPAC name is N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 99801920 |
| Molecular Formula | C13H19F3N6 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNc1c(C)c(C)nc2ncnn12)CC(F)(F)F |
| InChI | InChI=1S/C13H19F3N6/c1-4-21(7-13(14,15)16)6-5-17-11-9(2)10(3)20-12-18-8-19-22(11)12/h8,17H,4-7H2,1-3H3 |
| InChIKey | UCSAPJSDSUOZAW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |