C14H10ClFN4O — CID 99802237
2-chloro-3-fluoro-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)benzamide (PubChem CID 99802237) has the molecular formula C14H10ClFN4O and a molecular weight of 304.71 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-3-fluoro-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 99802237 |
| Molecular Formula | C14H10ClFN4O |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-chloro-3-fluoro-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1nc2ncccc2[nH]1)c1cccc(F)c1Cl |
| InChI | InChI=1S/C14H10ClFN4O/c15-12-8(3-1-4-9(12)16)14(21)18-7-11-19-10-5-2-6-17-13(10)20-11/h1-6H,7H2,(H,18,21)(H,17,19,20) |
| InChIKey | WOEYILYULPQPDE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |