C21H27ClN2O5 — CID 99802382
tert-butyl (3aR,6aS)-2-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 99802382) has the molecular formula C21H27ClN2O5 and a molecular weight of 422.91 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-2-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-2-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 99802382 |
| Molecular Formula | C21H27ClN2O5 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butyl (3aR,6aS)-2-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CN(C(=O)Cc3cc(Cl)c4c(c3)OCCO4)C[C@H]2C1 |
| InChI | InChI=1S/C21H27ClN2O5/c1-21(2,3)29-20(26)24-11-14-9-23(10-15(14)12-24)18(25)8-13-6-16(22)19-17(7-13)27-4-5-28-19/h6-7,14-15H,4-5,8-12H2,1-3H3/t14-,15+ |
| InChIKey | BTTOLKAVQXJMCF-GASCZTMLSA-N |
| XLogP | 2.98 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |