C25H30N4O3 — CID 99802515
1-[(3R)-5-(3-methylphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-3-[(3S)-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 99802515) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[(3R)-5-(3-methylphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-3-[(3S)-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 1-[(3R)-5-(3-methylphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-3-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99802515 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[(3R)-5-(3-methylphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-3-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | Cc1cccc(C2=NN(C(=O)CCN3CCC[C@H](C)C3)[C@@H](c3ccccc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-18-7-5-9-20(15-18)22-16-24(21-10-3-4-11-23(21)29(31)32)28(26-22)25(30)12-14-27-13-6-8-19(2)17-27/h3-5,7,9-11,15,19,24H,6,8,12-14,16-17H2,1-2H3/t19-,24+/m0/s1 |
| InChIKey | UDGIZZYVUDTVBX-YADARESESA-N |
| XLogP | 4.70 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|