C17H19F3N6 — CID 99802743
N-(2,2-difluoroethyl)-N'-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 99802743) has the molecular formula C17H19F3N6 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N-(2,2-difluoroethyl)-N'-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 99802743 |
| Molecular Formula | C17H19F3N6 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)c1ccc2nnc(-c3ccccc3F)n2n1)CC(F)F |
| InChI | InChI=1S/C17H19F3N6/c1-24(11-14(19)20)9-10-25(2)16-8-7-15-21-22-17(26(15)23-16)12-5-3-4-6-13(12)18/h3-8,14H,9-11H2,1-2H3 |
| InChIKey | LWNLFNNXSBTTGX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |