C20H18N4O2 — CID 99803272
3-phenylspiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,4'-oxane]-2-one (PubChem CID 99803272) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-phenylspiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,4'-oxane]-2-one.
| Compound Name | 3-phenylspiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,4'-oxane]-2-one |
|---|---|
| PubChem CID | 99803272 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-phenylspiro[7H-[1,2,4]triazino[2,3-c]quinazoline-6,4'-oxane]-2-one |
| SMILES | O=c1nc2n(nc1-c1ccccc1)C1(CCOCC1)Nc1ccccc1-2 |
| InChI | InChI=1S/C20H18N4O2/c25-19-17(14-6-2-1-3-7-14)23-24-18(21-19)15-8-4-5-9-16(15)22-20(24)10-12-26-13-11-20/h1-9,22H,10-13H2 |
| InChIKey | XRGFKHTXVLIXCI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |