C20H25N5OS — CID 99803603
2,5,7-trimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 99803603) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 2,5,7-trimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2,5,7-trimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 99803603 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2,5,7-trimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2nc(C)c(C(=O)NCCCc3nc4c(s3)CCCC4)c2n1 |
| InChI | InChI=1S/C20H25N5OS/c1-12-11-13(2)25-19(22-12)18(14(3)24-25)20(26)21-10-6-9-17-23-15-7-4-5-8-16(15)27-17/h11H,4-10H2,1-3H3,(H,21,26) |
| InChIKey | MRXZIAKWJQHCGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|