C19H19FN4O2 — CID 99804200
4-(4-fluorophenyl)-N'-(2-pyridin-3-ylacetyl)-3,6-dihydro-2H-pyridine-1-carbohydrazide (PubChem CID 99804200) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-(2-pyridin-3-ylacetyl)-3,6-dihydro-2H-pyridine-1-carbohydrazide.
| Compound Name | 4-(4-fluorophenyl)-N'-(2-pyridin-3-ylacetyl)-3,6-dihydro-2H-pyridine-1-carbohydrazide |
|---|---|
| PubChem CID | 99804200 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-(2-pyridin-3-ylacetyl)-3,6-dihydro-2H-pyridine-1-carbohydrazide |
| SMILES | O=C(Cc1cccnc1)NNC(=O)N1CC=C(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H19FN4O2/c20-17-5-3-15(4-6-17)16-7-10-24(11-8-16)19(26)23-22-18(25)12-14-2-1-9-21-13-14/h1-7,9,13H,8,10-12H2,(H,22,25)(H,23,26) |
| InChIKey | ABNHDWKFIWJPTR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|