C12H18N2O — CID 99804665
spiro[1,3,5,6,7,8-hexahydroquinazoline-2,1'-cyclopentane]-4-one (PubChem CID 99804665) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is spiro[1,3,5,6,7,8-hexahydroquinazoline-2,1'-cyclopentane]-4-one.
| Compound Name | spiro[1,3,5,6,7,8-hexahydroquinazoline-2,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 99804665 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | spiro[1,3,5,6,7,8-hexahydroquinazoline-2,1'-cyclopentane]-4-one |
| SMILES | O=C1NC2(CCCC2)NC2=C1CCCC2 |
| InChI | InChI=1S/C12H18N2O/c15-11-9-5-1-2-6-10(9)13-12(14-11)7-3-4-8-12/h13H,1-8H2,(H,14,15) |
| InChIKey | CSPHHEGHGJCGHH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |