C19H22N2O5S — CID 99805645
[2-[(3R)-3-methylpiperidin-1-yl]phenyl] 2-methyl-6-nitrobenzenesulfonate (PubChem CID 99805645) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]phenyl] 2-methyl-6-nitrobenzenesulfonate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]phenyl] 2-methyl-6-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 99805645 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]phenyl] 2-methyl-6-nitrobenzenesulfonate |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)Oc1ccccc1N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C19H22N2O5S/c1-14-7-6-12-20(13-14)16-9-3-4-11-18(16)26-27(24,25)19-15(2)8-5-10-17(19)21(22)23/h3-5,8-11,14H,6-7,12-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | BRVCXWGXWXSEBF-CQSZACIVSA-N |
| XLogP | 3.91 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|