C21H24N4OS2 — CID 99805808
azepan-1-yl-[(4R)-6-methyl-4-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]methanone (PubChem CID 99805808) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is azepan-1-yl-[(4R)-6-methyl-4-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]methanone.
| Compound Name | azepan-1-yl-[(4R)-6-methyl-4-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 99805808 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | azepan-1-yl-[(4R)-6-methyl-4-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]methanone |
| SMILES | CC1=C(C(=O)N2CCCCCC2)[C@H](c2nc(-c3ccccc3)cs2)NC(=S)N1 |
| InChI | InChI=1S/C21H24N4OS2/c1-14-17(20(26)25-11-7-2-3-8-12-25)18(24-21(27)22-14)19-23-16(13-28-19)15-9-5-4-6-10-15/h4-6,9-10,13,18H,2-3,7-8,11-12H2,1H3,(H2,22,24,27)/t18-/m1/s1 |
| InChIKey | IJMJDOITPKTCKH-GOSISDBHSA-N |
| XLogP | 4.01 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|