About 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide
2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide (PubChem CID 99810242) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide |
| PubChem CID | 99810242 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide |
| SMILES | CCO[C@H]1C[C@@H](N(C)C(=O)CC2CCCC2)C1(C)C |
| InChI | InChI=1S/C16H29NO2/c1-5-19-14-11-13(16(14,2)3)17(4)15(18)10-12-8-6-7-9-12/h12-14H,5-11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | LRFAPZCWIMEYMN-KGLIPLIRSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide?
The IUPAC name of 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide (CID 99810242) is 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide.
What is the SMILES notation for 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide?
The canonical SMILES for 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide is CCO[C@H]1C[C@@H](N(C)C(=O)CC2CCCC2)C1(C)C.
What is the InChIKey of 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide?
The InChIKey is LRFAPZCWIMEYMN-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H29NO2/c1-5-19-14-11-13(16(14,2)3)17(4)15(18)10-12-8-6-7-9-12/h12-14H,5-11H2,1-4H3/t13-,14+/m1/s1.
What are the key properties of 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide?
2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide has a molecular weight of 267.41 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[(1R,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylacetamide is sourced from PubChem (CID 99810242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).