C15H25N3O3 — CID 99811031
N'-[(1S,2S)-2-cyclohexylcyclopropanecarbonyl]morpholine-4-carbohydrazide (PubChem CID 99811031) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N'-[(1S,2S)-2-cyclohexylcyclopropanecarbonyl]morpholine-4-carbohydrazide.
| Compound Name | N'-[(1S,2S)-2-cyclohexylcyclopropanecarbonyl]morpholine-4-carbohydrazide |
|---|---|
| PubChem CID | 99811031 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N'-[(1S,2S)-2-cyclohexylcyclopropanecarbonyl]morpholine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)N1CCOCC1)[C@H]1C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C15H25N3O3/c19-14(13-10-12(13)11-4-2-1-3-5-11)16-17-15(20)18-6-8-21-9-7-18/h11-13H,1-10H2,(H,16,19)(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | GCPODFBXNKWMFY-STQMWFEESA-N |
| XLogP | 1.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|