About 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone
3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone (PubChem CID 99811069) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone.
Molecular Properties
| Compound Name | 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone |
| PubChem CID | 99811069 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone |
| SMILES | C[C@@H]1CCC[C@@H](C)N(C(=O)c2cc3c(ccc4ccccc43)[nH]2)C1 |
| InChI | InChI=1S/C21H24N2O/c1-14-6-5-7-15(2)23(13-14)21(24)20-12-18-17-9-4-3-8-16(17)10-11-19(18)22-20/h3-4,8-12,14-15,22H,5-7,13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | APUTVOPWWLJLEB-HUUCEWRRSA-N |
| XLogP | 4.97 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone?
The IUPAC name of 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone (CID 99811069) is 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone.
What is the SMILES notation for 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone?
The canonical SMILES for 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone is C[C@@H]1CCC[C@@H](C)N(C(=O)c2cc3c(ccc4ccccc43)[nH]2)C1.
What is the InChIKey of 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone?
The InChIKey is APUTVOPWWLJLEB-HUUCEWRRSA-N. The full InChI is InChI=1S/C21H24N2O/c1-14-6-5-7-15(2)23(13-14)21(24)20-12-18-17-9-4-3-8-16(17)10-11-19(18)22-20/h3-4,8-12,14-15,22H,5-7,13H2,1-2H3/t14-,15-/m1/s1.
What are the key properties of 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone?
3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone has a molecular weight of 320.44 g/mol, XLogP of 4.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-benzo[e]indol-2-yl-[(2R,6R)-2,6-dimethylazepan-1-yl]methanone is sourced from PubChem (CID 99811069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).