About N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine
N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 99811179) has the molecular formula C16H22F3N3O
and a molecular weight of 329.37 g/mol. Its IUPAC name is N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 99811179 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCO[C@H]1C[C@H](Nc2nccc(C(F)(F)F)n2)C12CCCCC2 |
| InChI | InChI=1S/C16H22F3N3O/c1-2-23-13-10-12(15(13)7-4-3-5-8-15)22-14-20-9-6-11(21-14)16(17,18)19/h6,9,12-13H,2-5,7-8,10H2,1H3,(H,20,21,22)/t12-,13-/m0/s1 |
| InChIKey | JODIFRYUSYKERB-STQMWFEESA-N |
| XLogP | 4.04 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine (CID 99811179) is N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine is CCO[C@H]1C[C@H](Nc2nccc(C(F)(F)F)n2)C12CCCCC2.
What is the InChIKey of N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is JODIFRYUSYKERB-STQMWFEESA-N. The full InChI is InChI=1S/C16H22F3N3O/c1-2-23-13-10-12(15(13)7-4-3-5-8-15)22-14-20-9-6-11(21-14)16(17,18)19/h6,9,12-13H,2-5,7-8,10H2,1H3,(H,20,21,22)/t12-,13-/m0/s1.
What are the key properties of N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine?
N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 329.37 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-4-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 99811179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).