C16H14ClN5S — CID 99812253
2-chloro-6-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine (PubChem CID 99812253) has the molecular formula C16H14ClN5S and a molecular weight of 343.84 g/mol. Its IUPAC name is 2-chloro-6-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-6-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 99812253 |
| Molecular Formula | C16H14ClN5S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-chloro-6-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
| SMILES | Clc1cccc(CSc2nnc(-c3cccnc3)n2C2CC2)n1 |
| InChI | InChI=1S/C16H14ClN5S/c17-14-5-1-4-12(19-14)10-23-16-21-20-15(22(16)13-6-7-13)11-3-2-8-18-9-11/h1-5,8-9,13H,6-7,10H2 |
| InChIKey | VJEYIFKJSJCCCS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|