C21H24N4O2S — CID 99812567
4-(4-methylphenyl)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-1,4-diazepane-1-carboxamide (PubChem CID 99812567) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(4-methylphenyl)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 99812567 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-(4-methylphenyl)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-1,4-diazepane-1-carboxamide |
| SMILES | Cc1ccc(N2CCCN(C(=O)NCc3coc(-c4cccs4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-16-5-7-18(8-6-16)24-9-3-10-25(12-11-24)21(26)22-14-17-15-27-20(23-17)19-4-2-13-28-19/h2,4-8,13,15H,3,9-12,14H2,1H3,(H,22,26) |
| InChIKey | LPMYBWGCQKAZKN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|