C13H17BrN4O2S — CID 99812664
5-bromo-3-methyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]furan-2-carboxamide (PubChem CID 99812664) has the molecular formula C13H17BrN4O2S and a molecular weight of 373.28 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 99812664 |
| Molecular Formula | C13H17BrN4O2S |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 5-bromo-3-methyl-N-[2-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]furan-2-carboxamide |
| SMILES | Cc1cc(Br)oc1C(=O)NCCn1c(C(C)C)n[nH]c1=S |
| InChI | InChI=1S/C13H17BrN4O2S/c1-7(2)11-16-17-13(21)18(11)5-4-15-12(19)10-8(3)6-9(14)20-10/h6-7H,4-5H2,1-3H3,(H,15,19)(H,17,21) |
| InChIKey | MHZAOTVOHUWIES-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|