About (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide
(3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide (PubChem CID 99813033) has the molecular formula C11H19F3N2OS
and a molecular weight of 284.35 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide |
| PubChem CID | 99813033 |
| Molecular Formula | C11H19F3N2OS |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)NCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2OS/c1-8-5-9(2)7-16(6-8)10(17)15-3-4-18-11(12,13)14/h8-9H,3-7H2,1-2H3,(H,15,17)/t8-,9-/m0/s1 |
| InChIKey | IIRZBFRTKQYSGH-IUCAKERBSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide?
The IUPAC name of (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide (CID 99813033) is (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide.
What is the SMILES notation for (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide?
The canonical SMILES for (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide is C[C@H]1C[C@H](C)CN(C(=O)NCCSC(F)(F)F)C1.
What is the InChIKey of (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide?
The InChIKey is IIRZBFRTKQYSGH-IUCAKERBSA-N. The full InChI is InChI=1S/C11H19F3N2OS/c1-8-5-9(2)7-16(6-8)10(17)15-3-4-18-11(12,13)14/h8-9H,3-7H2,1-2H3,(H,15,17)/t8-,9-/m0/s1.
What are the key properties of (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide?
(3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide has a molecular weight of 284.35 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-carboxamide is sourced from PubChem (CID 99813033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).