About 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide
4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide (PubChem CID 99813382) has the molecular formula C16H17FN2O5S
and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide |
| PubChem CID | 99813382 |
| Molecular Formula | C16H17FN2O5S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccon1)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C16H17FN2O5S/c17-13-3-1-2-12(10-13)16(5-8-23-9-6-16)15(20)19-25(21,22)11-14-4-7-24-18-14/h1-4,7,10H,5-6,8-9,11H2,(H,19,20) |
| InChIKey | FFXSOUYQXVGSQJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide?
The IUPAC name of 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide (CID 99813382) is 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide.
What is the SMILES notation for 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide?
The canonical SMILES for 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide is O=C(NS(=O)(=O)Cc1ccon1)C1(c2cccc(F)c2)CCOCC1.
What is the InChIKey of 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide?
The InChIKey is FFXSOUYQXVGSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O5S/c17-13-3-1-2-12(10-13)16(5-8-23-9-6-16)15(20)19-25(21,22)11-14-4-7-24-18-14/h1-4,7,10H,5-6,8-9,11H2,(H,19,20).
What are the key properties of 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide?
4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide has a molecular weight of 368.39 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-N-(1,2-oxazol-3-ylmethylsulfonyl)oxane-4-carboxamide is sourced from PubChem (CID 99813382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).