C16H22N4O2S — CID 99813421
(2R,3R)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxy-2-methyl-3-phenylbutanamide (PubChem CID 99813421) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is (2R,3R)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxy-2-methyl-3-phenylbutanamide.
| Compound Name | (2R,3R)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxy-2-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 99813421 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R,3R)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-hydroxy-2-methyl-3-phenylbutanamide |
| SMILES | CCn1c(CNC(=O)[C@](C)(O)[C@H](C)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C16H22N4O2S/c1-4-20-13(18-19-15(20)23)10-17-14(21)16(3,22)11(2)12-8-6-5-7-9-12/h5-9,11,22H,4,10H2,1-3H3,(H,17,21)(H,19,23)/t11-,16-/m1/s1 |
| InChIKey | MUKPPXTVWNCQIK-BDJLRTHQSA-N |
| XLogP | 2.13 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|