About 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea
1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea (PubChem CID 99813954) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea |
| PubChem CID | 99813954 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea |
| SMILES | CCO[C@@H]1C[C@@H](N(C)C(=O)Nc2ccn(C)n2)C12CCCCC2 |
| InChI | InChI=1S/C17H28N4O2/c1-4-23-14-12-13(17(14)9-6-5-7-10-17)21(3)16(22)18-15-8-11-20(2)19-15/h8,11,13-14H,4-7,9-10,12H2,1-3H3,(H,18,19,22)/t13-,14-/m1/s1 |
| InChIKey | FUSQBCIWUCKOPZ-ZIAGYGMSSA-N |
| XLogP | 3.01 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea?
The IUPAC name of 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea (CID 99813954) is 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea.
What is the SMILES notation for 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea?
The canonical SMILES for 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea is CCO[C@@H]1C[C@@H](N(C)C(=O)Nc2ccn(C)n2)C12CCCCC2.
What is the InChIKey of 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea?
The InChIKey is FUSQBCIWUCKOPZ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H28N4O2/c1-4-23-14-12-13(17(14)9-6-5-7-10-17)21(3)16(22)18-15-8-11-20(2)19-15/h8,11,13-14H,4-7,9-10,12H2,1-3H3,(H,18,19,22)/t13-,14-/m1/s1.
What are the key properties of 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea?
1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea has a molecular weight of 320.44 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-1-methyl-3-(1-methylpyrazol-3-yl)urea is sourced from PubChem (CID 99813954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).