About 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide
3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide (PubChem CID 99814121) has the molecular formula C15H22N4O2S
and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide |
| PubChem CID | 99814121 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide |
| SMILES | CN(C)[C@@H]1CCC[C@@H](Nc2ccc(S(N)(=O)=O)cc2C#N)C1 |
| InChI | InChI=1S/C15H22N4O2S/c1-19(2)13-5-3-4-12(9-13)18-15-7-6-14(22(17,20)21)8-11(15)10-16/h6-8,12-13,18H,3-5,9H2,1-2H3,(H2,17,20,21)/t12-,13-/m1/s1 |
| InChIKey | PSRNEVOBVFBCIE-CHWSQXEVSA-N |
| XLogP | 1.49 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide?
The IUPAC name of 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide (CID 99814121) is 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide.
What is the SMILES notation for 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide?
The canonical SMILES for 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide is CN(C)[C@@H]1CCC[C@@H](Nc2ccc(S(N)(=O)=O)cc2C#N)C1.
What is the InChIKey of 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide?
The InChIKey is PSRNEVOBVFBCIE-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H22N4O2S/c1-19(2)13-5-3-4-12(9-13)18-15-7-6-14(22(17,20)21)8-11(15)10-16/h6-8,12-13,18H,3-5,9H2,1-2H3,(H2,17,20,21)/t12-,13-/m1/s1.
What are the key properties of 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide?
3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide has a molecular weight of 322.43 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4-[[(1R,3R)-3-(dimethylamino)cyclohexyl]amino]benzenesulfonamide is sourced from PubChem (CID 99814121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).