C15H14F4N4OS — CID 99814629
N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 99814629) has the molecular formula C15H14F4N4OS and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99814629 |
| Molecular Formula | C15H14F4N4OS |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCn1c(C2CC2)n[nH]c1=S)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C15H14F4N4OS/c16-11-9(2-1-3-10(11)15(17,18)19)13(24)20-6-7-23-12(8-4-5-8)21-22-14(23)25/h1-3,8H,4-7H2,(H,20,24)(H,22,25) |
| InChIKey | SYFIJIGEXYOQTG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|