C11H20F3N3 — CID 99814830
1,2-dimethyl-3-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]methyl]guanidine (PubChem CID 99814830) has the molecular formula C11H20F3N3 and a molecular weight of 251.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 99814830 |
| Molecular Formula | C11H20F3N3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1,2-dimethyl-3-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]methyl]guanidine |
| SMILES | C/N=C(\NC)NC[C@@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3N3/c1-15-10(16-2)17-7-8-4-3-5-9(6-8)11(12,13)14/h8-9H,3-7H2,1-2H3,(H2,15,16,17)/t8-,9-/m1/s1 |
| InChIKey | YNWBXCFHRQTIIM-RKDXNWHRSA-N |
| XLogP | 2.15 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|