About (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol
(2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol (PubChem CID 99816161) has the molecular formula C15H17N5O3
and a molecular weight of 315.33 g/mol. Its IUPAC name is (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol |
| PubChem CID | 99816161 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol |
| SMILES | Cc1cc2ncn(C[C@H](O)Cn3ccc([N+](=O)[O-])n3)c2cc1C |
| InChI | InChI=1S/C15H17N5O3/c1-10-5-13-14(6-11(10)2)18(9-16-13)7-12(21)8-19-4-3-15(17-19)20(22)23/h3-6,9,12,21H,7-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | UTIVURMLEJZCGG-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol?
The IUPAC name of (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol (CID 99816161) is (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol.
What is the SMILES notation for (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol?
The canonical SMILES for (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol is Cc1cc2ncn(C[C@H](O)Cn3ccc([N+](=O)[O-])n3)c2cc1C.
What is the InChIKey of (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol?
The InChIKey is UTIVURMLEJZCGG-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H17N5O3/c1-10-5-13-14(6-11(10)2)18(9-16-13)7-12(21)8-19-4-3-15(17-19)20(22)23/h3-6,9,12,21H,7-8H2,1-2H3/t12-/m0/s1.
What are the key properties of (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol?
(2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol has a molecular weight of 315.33 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(5,6-dimethylbenzimidazol-1-yl)-3-(3-nitropyrazol-1-yl)propan-2-ol is sourced from PubChem (CID 99816161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).